Products 802616-47-3

CAS 802616-47-3 is the registry number for 2,6-Dichloro-4-(methoxycarbonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,6-dichloro-4-methoxycarbonylbenzoic acid (CAS 802616-47-3) is a chemical compound with the molecular formula C9H6Cl2O4 and a molecular weight of 249.04 g/mol. IUPAC name: 2,6-dichloro-4-methoxycarbonylbenzoic acid. InChIKey: VZSMXGRLRWSYDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6Cl2O4
Molecular weight249.04 g/mol
IUPAC name2,6-dichloro-4-methoxycarbonylbenzoic acid
InChIKeyVZSMXGRLRWSYDQ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C(=C1)Cl)C(=O)O)Cl

Computed by PubChem (NCBI)