CAS 264272-64-2 appears in our catalog under these names: 3,5-Dichloro-4-(methoxycarbonyl)benzoic Acid, 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid 97%, 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid, 97%, 97%, 3,5-DICHLORO-4-(METHOXYCARBONYL)BENZOIC ACID, 97%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 500mg, 50mg, 250mg, 1g, 5g, 25g.
3,5-dichloro-4-methoxycarbonylbenzoic acid (CAS 264272-64-2) is a chemical compound with the molecular formula C9H6Cl2O4 and a molecular weight of 249.04 g/mol. IUPAC name: 3,5-dichloro-4-methoxycarbonylbenzoic acid. InChIKey: HEPDHTNDZDMUBB-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O4 |
|---|---|
| Molecular weight | 249.04 g/mol |
| IUPAC name | 3,5-dichloro-4-methoxycarbonylbenzoic acid |
| InChIKey | HEPDHTNDZDMUBB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)