Products 52268-21-0

CAS 52268-21-0 is the registry number for 2-(2,6-Dichloro-4-formylphenoxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2,6-dichloro-4-formylphenoxy)acetic acid (CAS 52268-21-0) is a chemical compound with the molecular formula C9H6Cl2O4 and a molecular weight of 249.04 g/mol. IUPAC name: 2-(2,6-dichloro-4-formylphenoxy)acetic acid. InChIKey: NBKUITQBQNMEDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6Cl2O4
Molecular weight249.04 g/mol
IUPAC name2-(2,6-dichloro-4-formylphenoxy)acetic acid
InChIKeyNBKUITQBQNMEDQ-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Cl)OCC(=O)O)Cl)C=O

Computed by PubChem (NCBI)