CAS 1443448-82-5 appears in our catalog under these names: SEMBL, 2-Hydroxy-n-[(3s)-4-methylene-5-oxo-tetrahydrofuran-3-yl]benzamide, 95%, 2-Hydroxy-N-((3S)-4-methylene-5-oxo-tetrahydrofuran-3-yl)benzamide, SEMBL, 99.16%. Offered by: GLPBio, Combi-blocks, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1g, 250mg, 100mg, 10mg, 10mM (in 1ml dmso), 25mg, 50mg.
2-hydroxy-N-[(3S)-4-methylidene-5-oxooxolan-3-yl]benzamide (CAS 1443448-82-5) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 2-hydroxy-N-[(3S)-4-methylidene-5-oxooxolan-3-yl]benzamide. InChIKey: SBEBFCLNXGMFOQ-SECBINFHSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2-hydroxy-N-[(3S)-4-methylidene-5-oxooxolan-3-yl]benzamide |
| InChIKey | SBEBFCLNXGMFOQ-SECBINFHSA-N |
| SMILES | C=C1[C@@H](COC1=O)NC(=O)C2=CC=CC=C2O |
Computed by PubChem (NCBI)