Products 1805450-24-1
CAS 1805450-24-1 is the registry number for Methyl 5-amino-2-bromo-4-(trifluoromethyl)benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-amino-2-bromo-4-(trifluoromethyl)benzoate (CAS 1805450-24-1) is a chemical compound with the molecular formula C9H7BrF3NO2 and a molecular weight of 298.06 g/mol. IUPAC name: methyl 5-amino-2-bromo-4-(trifluoromethyl)benzoate. InChIKey: AWLQCYLZRAOIDJ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3NO2 |
|---|---|
| Molecular weight | 298.06 g/mol |
| IUPAC name | methyl 5-amino-2-bromo-4-(trifluoromethyl)benzoate |
| InChIKey | AWLQCYLZRAOIDJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Br)C(F)(F)F)N |
Computed by PubChem (NCBI)