CAS 1443979-70-1 appears in our catalog under these names: 3-Amino-1-ethyl-5-methyl-2,3-dihydro-1H-indol-2-one hydrochloride, 95%, 3-Amino-1-ethyl-5-methyl-2,3-dihydro-1H-indol-2-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-amino-1-ethyl-5-methyl-3H-indol-2-one;hydrochloride (CAS 1443979-70-1) is a chemical compound with the molecular formula C11H15ClN2O and a molecular weight of 226.70 g/mol. IUPAC name: 3-amino-1-ethyl-5-methyl-3H-indol-2-one;hydrochloride. InChIKey: OQBGOPVMCFUXHQ-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 3-amino-1-ethyl-5-methyl-3H-indol-2-one;hydrochloride |
| InChIKey | OQBGOPVMCFUXHQ-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C)C(C1=O)N.Cl |
Computed by PubChem (NCBI)