CAS 1443981-81-4 appears in our catalog under these names: 1-(Trifluoromethyl)-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%, 1-(Trifluoromethyl)-2,3-dihydro-1H-inden-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(trifluoromethyl)-2,3-dihydroinden-1-amine;hydrochloride (CAS 1443981-81-4) is a chemical compound with the molecular formula C10H11ClF3N and a molecular weight of 237.65 g/mol. IUPAC name: 1-(trifluoromethyl)-2,3-dihydroinden-1-amine;hydrochloride. InChIKey: MGSDNNBIVWUQSW-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3N |
|---|---|
| Molecular weight | 237.65 g/mol |
| IUPAC name | 1-(trifluoromethyl)-2,3-dihydroinden-1-amine;hydrochloride |
| InChIKey | MGSDNNBIVWUQSW-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C21)(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)