CAS 1443986-68-2 is the registry number for (1-Methyl-1H-benzo[d][1,2,3]triazol-6-yl)boronic acid, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(3-methylbenzotriazol-5-yl)boronic acid (CAS 1443986-68-2) is a chemical compound with the molecular formula C7H8BN3O2 and a molecular weight of 176.97 g/mol. IUPAC name: (3-methylbenzotriazol-5-yl)boronic acid. InChIKey: HOACZEXGGFAODP-UHFFFAOYSA-N.
| Molecular formula | C7H8BN3O2 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (3-methylbenzotriazol-5-yl)boronic acid |
| InChIKey | HOACZEXGGFAODP-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N=NN2C)(O)O |
Computed by PubChem (NCBI)