CAS 2818960-44-8 is the registry number for (8-Methyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(8-methyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)boronic acid (CAS 2818960-44-8) is a chemical compound with the molecular formula C7H8BN3O2 and a molecular weight of 176.97 g/mol. IUPAC name: (8-methyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)boronic acid. InChIKey: JVNIIYYHSPWSHM-UHFFFAOYSA-N.
| Molecular formula | C7H8BN3O2 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (8-methyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)boronic acid |
| InChIKey | JVNIIYYHSPWSHM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C2=NN=CN2C=C1)C)(O)O |
Computed by PubChem (NCBI)