CAS 2402783-58-6 is the registry number for (5-Methyl-1H-pyrazolo[3,4-c]pyridin-4-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-methyl-1H-pyrazolo[3,4-c]pyridin-4-yl)boronic acid (CAS 2402783-58-6) is a chemical compound with the molecular formula C7H8BN3O2 and a molecular weight of 176.97 g/mol. IUPAC name: (5-methyl-1H-pyrazolo[3,4-c]pyridin-4-yl)boronic acid. InChIKey: SMHUGEGNLGDKEU-UHFFFAOYSA-N.
| Molecular formula | C7H8BN3O2 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (5-methyl-1H-pyrazolo[3,4-c]pyridin-4-yl)boronic acid |
| InChIKey | SMHUGEGNLGDKEU-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=NNC2=CN=C1C)(O)O |
Computed by PubChem (NCBI)