CAS 1598409-66-5 is the registry number for (1-Methyl-1H-pyrazolo[3,4-b]pyridin-5-yl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1-methylpyrazolo[5,4-b]pyridin-5-yl)boronic acid (CAS 1598409-66-5) is a chemical compound with the molecular formula C7H8BN3O2 and a molecular weight of 176.97 g/mol. IUPAC name: (1-methylpyrazolo[5,4-b]pyridin-5-yl)boronic acid. InChIKey: SEAQLWBGPAEIKW-UHFFFAOYSA-N.
| Molecular formula | C7H8BN3O2 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (1-methylpyrazolo[5,4-b]pyridin-5-yl)boronic acid |
| InChIKey | SEAQLWBGPAEIKW-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N=C1)N(N=C2)C)(O)O |
Computed by PubChem (NCBI)