CAS 1444-65-1 appears in our catalog under these names: 2-Phenylcyclohexanone, 2–Phenylcyclohexanone, 2-Phenylcyclohexanone, 98% , 2-Phenylcyclohexanone, >98.0%(GC), 2-Phenylcyclohexanone 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 500g, 250mg, 50g.
2-phenylcyclohexan-1-one (CAS 1444-65-1) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 2-phenylcyclohexan-1-one. InChIKey: DRLVMOAWNVOSPE-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 2-phenylcyclohexan-1-one |
| InChIKey | DRLVMOAWNVOSPE-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C(C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)