Products 144433-66-9

CAS 144433-66-9 is the registry number for 2-Hydroxy-6-(trifluoromethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-hydroxy-6-(trifluoromethyl)benzoic acid (CAS 144433-66-9) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2-hydroxy-6-(trifluoromethyl)benzoic acid. InChIKey: WFRWCWJAKXBJCK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F3O3
Molecular weight206.12 g/mol
IUPAC name2-hydroxy-6-(trifluoromethyl)benzoic acid
InChIKeyWFRWCWJAKXBJCK-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)O)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)