CAS 144486-08-8 appears in our catalog under these names: 3-Methyl-2-hydroxy-3h-imidazo[4,5-f]quinoline, 95%, 3-Methyl-2-hydroxy-3H-imidazo(4,5-f)quinoline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 25mg, 10mg, 50mg.
3-methyl-1H-imidazo[4,5-f]quinolin-2-one (CAS 144486-08-8) is a chemical compound with the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. IUPAC name: 3-methyl-1H-imidazo[4,5-f]quinolin-2-one. InChIKey: GSUQMXXXXPNYEA-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O |
|---|---|
| Molecular weight | 199.21 g/mol |
| IUPAC name | 3-methyl-1H-imidazo[4,5-f]quinolin-2-one |
| InChIKey | GSUQMXXXXPNYEA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C3=C(C=C2)N=CC=C3)NC1=O |
Computed by PubChem (NCBI)