CAS 945347-58-0 is the registry number for 2-(Furan-2-ylmethylamino)nicotinonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(furan-2-ylmethylamino)pyridine-3-carbonitrile (CAS 945347-58-0) is a chemical compound with the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. IUPAC name: 2-(furan-2-ylmethylamino)pyridine-3-carbonitrile. InChIKey: KXZBGSYFNVDYJE-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O |
|---|---|
| Molecular weight | 199.21 g/mol |
| IUPAC name | 2-(furan-2-ylmethylamino)pyridine-3-carbonitrile |
| InChIKey | KXZBGSYFNVDYJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NCC2=CC=CO2)C#N |
Computed by PubChem (NCBI)