CAS 1447607-59-1 is the registry number for 5-(Pyridin-4-yl)-2,3-diazabicyclo[4.2.0]octa-1,5-dien-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
5-pyridin-4-yl-2,3-diazabicyclo[4.2.0]octa-1,5-dien-4-one (CAS 1447607-59-1) is a chemical compound with the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. IUPAC name: 5-pyridin-4-yl-2,3-diazabicyclo[4.2.0]octa-1,5-dien-4-one. InChIKey: UKCQMDNEVRIZLE-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O |
|---|---|
| Molecular weight | 199.21 g/mol |
| IUPAC name | 5-pyridin-4-yl-2,3-diazabicyclo[4.2.0]octa-1,5-dien-4-one |
| InChIKey | UKCQMDNEVRIZLE-UHFFFAOYSA-N |
| SMILES | C1CC2=NNC(=O)C(=C21)C3=CC=NC=C3 |
Computed by PubChem (NCBI)