CAS 79652-37-2 appears in our catalog under these names: 8-Methyl-3,5-dihydro-4h-pyridazino[4,5-b]indol-4-one, 95%, 8-Methyl-3H,4H,5H-pyridazino(4,5-b)indol-4-one, 98%, 8-Methyl-3H,4H,5H-pyridazino(4,5-b)indol-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one (CAS 79652-37-2) is a chemical compound with the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. IUPAC name: 8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one. InChIKey: VBWJMUHVGCOFHX-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O |
|---|---|
| Molecular weight | 199.21 g/mol |
| IUPAC name | 8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one |
| InChIKey | VBWJMUHVGCOFHX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2C=NNC3=O |
Computed by PubChem (NCBI)