Products 1445831-49-1
CAS 1445831-49-1 is the registry number for Ethyl 4-cyclopropyl-3-methyl-2,4-dioxobutanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 4-cyclopropyl-3-methyl-2,4-dioxobutanoate (CAS 1445831-49-1) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: ethyl 4-cyclopropyl-3-methyl-2,4-dioxobutanoate. InChIKey: JTGJEXZUMXEBLT-UHFFFAOYSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | ethyl 4-cyclopropyl-3-methyl-2,4-dioxobutanoate |
| InChIKey | JTGJEXZUMXEBLT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C(C)C(=O)C1CC1 |
Computed by PubChem (NCBI)