CAS 1445906-51-3 appears in our catalog under these names: 4-Bromo-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid, 4-Bromo-2-(trifluoromethyl)thiazole-5-carboxylic acid, 98%, 98%, 4-BROMO-2-(TRIFLUOROMETHYL)THIAZOLE-5-CARBOXYLIC ACID, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4-bromo-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS 1445906-51-3) is a chemical compound with the molecular formula C5HBrF3NO2S and a molecular weight of 276.03 g/mol. IUPAC name: 4-bromo-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: OMFOOUVRYKHHIJ-UHFFFAOYSA-N.
| Molecular formula | C5HBrF3NO2S |
|---|---|
| Molecular weight | 276.03 g/mol |
| IUPAC name | 4-bromo-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | OMFOOUVRYKHHIJ-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(S1)C(F)(F)F)Br)C(=O)O |
Computed by PubChem (NCBI)