Products 2138103-97-4
CAS 2138103-97-4 is the registry number for 5-Bromo-4-(trifluoromethyl)thiazole-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-4-(trifluoromethyl)-1,3-thiazole-2-carboxylic acid (CAS 2138103-97-4) is a chemical compound with the molecular formula C5HBrF3NO2S and a molecular weight of 276.03 g/mol. IUPAC name: 5-bromo-4-(trifluoromethyl)-1,3-thiazole-2-carboxylic acid. InChIKey: XTKQLDZOIUVJFU-UHFFFAOYSA-N.
| Molecular formula | C5HBrF3NO2S |
|---|---|
| Molecular weight | 276.03 g/mol |
| IUPAC name | 5-bromo-4-(trifluoromethyl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | XTKQLDZOIUVJFU-UHFFFAOYSA-N |
| SMILES | C1(=C(SC(=N1)C(=O)O)Br)C(F)(F)F |
Computed by PubChem (NCBI)