CAS 162651-07-2 appears in our catalog under these names: 2–Bromo–4–(trifluoromethyl)thiazole–5–carboxylic Acid, 2-Bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid, 97%, 2-Bromo-4-(trifluoromethyl)thiazole-5-carboxylic acid, 95-<97%, 2-Bromo-4-(trifluoromethyl)thiazole-5-carboxylic acid, ≥97-<99%, 2-Bromo-4-(trifluoromethyl)thiazole-5-carboxylic acid, 97%. Offered by: GLPBio, Combi-blocks, Hoffman Fine Chemicals, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 100g, 100mg.
2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS 162651-07-2) is a chemical compound with the molecular formula C5HBrF3NO2S and a molecular weight of 276.03 g/mol. IUPAC name: 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: KDDAZSADIUMSBH-UHFFFAOYSA-N.
| Molecular formula | C5HBrF3NO2S |
|---|---|
| Molecular weight | 276.03 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | KDDAZSADIUMSBH-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(S1)Br)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)