Products 1628451-87-5
CAS 1628451-87-5 is the registry number for 5-Bromo-3-(trifluoromethyl)isothiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-(trifluoromethyl)-1,2-thiazole-4-carboxylic acid (CAS 1628451-87-5) is a chemical compound with the molecular formula C5HBrF3NO2S and a molecular weight of 276.03 g/mol. IUPAC name: 5-bromo-3-(trifluoromethyl)-1,2-thiazole-4-carboxylic acid. InChIKey: OBADAPPKDBSNMT-UHFFFAOYSA-N.
| Molecular formula | C5HBrF3NO2S |
|---|---|
| Molecular weight | 276.03 g/mol |
| IUPAC name | 5-bromo-3-(trifluoromethyl)-1,2-thiazole-4-carboxylic acid |
| InChIKey | OBADAPPKDBSNMT-UHFFFAOYSA-N |
| SMILES | C1(=C(SN=C1C(F)(F)F)Br)C(=O)O |
Computed by PubChem (NCBI)