CAS 14463-79-7 appears in our catalog under these names: 2-Methyl-2-phthalimido propanoic acid, 95%, 2-(1,3-DIOXO-2,3-DIHYDRO-1H-ISOINDOL-2-YL)-2-METHYLPROPANOIC ACID, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-(1,3-dioxoisoindol-2-yl)-2-methylpropanoic acid (CAS 14463-79-7) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-2-methylpropanoic acid. InChIKey: FPOSIYHINNEBSP-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)-2-methylpropanoic acid |
| InChIKey | FPOSIYHINNEBSP-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)