CAS 1446412-22-1 appears in our catalog under these names: 3,3-Dimethylindolin-6-amine hydrochloride, 95%, 3,3-Dimethylindolin-6-amine hydrochloride, 97%, 3,3–Dimethylindolin–6–amine hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
3,3-dimethyl-1,2-dihydroindol-6-amine;hydrochloride (CAS 1446412-22-1) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: 3,3-dimethyl-1,2-dihydroindol-6-amine;hydrochloride. InChIKey: XNZDKQWQYXDSAP-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2 |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | 3,3-dimethyl-1,2-dihydroindol-6-amine;hydrochloride |
| InChIKey | XNZDKQWQYXDSAP-UHFFFAOYSA-N |
| SMILES | CC1(CNC2=C1C=CC(=C2)N)C.Cl |
Computed by PubChem (NCBI)