Products 927965-80-8
CAS 927965-80-8 appears in our catalog under these names: [2-Amino-1-(4-chlorophenyl)ethyl]dimethylamine, 97%, 1-(4-Chlorophenyl)-N1,N1-dimethylethane-1,2-diamine, 97%, (2-Amino-1-(4-chlorophenyl)ethyl)dimethylamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g.
1-(4-chlorophenyl)-N,N-dimethylethane-1,2-diamine (CAS 927965-80-8) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: 1-(4-chlorophenyl)-N,N-dimethylethane-1,2-diamine. InChIKey: MIDAWEXSYYTARE-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2 |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-N,N-dimethylethane-1,2-diamine |
| InChIKey | MIDAWEXSYYTARE-UHFFFAOYSA-N |
| SMILES | CN(C)C(CN)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)