CAS 68155-76-0 is the registry number for (4-Amino-2-chlorophenyl)diethylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-chloro-1-N,1-N-diethylbenzene-1,4-diamine (CAS 68155-76-0) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: 2-chloro-1-N,1-N-diethylbenzene-1,4-diamine. InChIKey: JLPRWBZGPHCRIH-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2 |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | 2-chloro-1-N,1-N-diethylbenzene-1,4-diamine |
| InChIKey | JLPRWBZGPHCRIH-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=C(C=C(C=C1)N)Cl |
Computed by PubChem (NCBI)