Products 2061996-91-4
CAS 2061996-91-4 appears in our catalog under these names: (R)-3-(Pyrrolidin-2-yl)aniline hydrochloride, 95%, (R)–3–(Pyrrolidin–2–yl)aniline hydrochloride, (R)-3-(Pyrrolidin-2-yl)aniline hydrochloride 97%, (R)-3-(Pyrrolidin-2-yl)aniline hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
3-[(2R)-pyrrolidin-2-yl]aniline;hydrochloride (CAS 2061996-91-4) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: 3-[(2R)-pyrrolidin-2-yl]aniline;hydrochloride. InChIKey: HFVXLQWMCBMRJE-HNCPQSOCSA-N.
| Molecular formula | C10H15ClN2 |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | 3-[(2R)-pyrrolidin-2-yl]aniline;hydrochloride |
| InChIKey | HFVXLQWMCBMRJE-HNCPQSOCSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)