Products 1446443-12-4
CAS 1446443-12-4 appears in our catalog under these names: 4-Azaindole-7-boronic acid pinacol ester, 95%, 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[3,2-b]pyridine, 97%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg.
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[3,2-b]pyridine (CAS 1446443-12-4) is a chemical compound with the molecular formula C13H17BN2O2 and a molecular weight of 244.10 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[3,2-b]pyridine. InChIKey: MPCVXMZSPIKSCI-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O2 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | MPCVXMZSPIKSCI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=NC=C2)C=CN3 |
Computed by PubChem (NCBI)