CAS 144690-06-2 appears in our catalog under these names: 5-acetyl-2-propyl-1H-imidazole-4-carbonitrile, Olmesartan Medoxomil Impurity 86, Olmesartan Impurity 65. Offered by: Chemat, Chemat Brand, Hubei YoungXin. Available pack sizes: 1g, on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-acetyl-2-propyl-1H-imidazole-4-carbonitrile (CAS 144690-06-2) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 5-acetyl-2-propyl-1H-imidazole-4-carbonitrile. InChIKey: ILQNHPWHRSDNHX-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 5-acetyl-2-propyl-1H-imidazole-4-carbonitrile |
| InChIKey | ILQNHPWHRSDNHX-UHFFFAOYSA-N |
| SMILES | CCCC1=NC(=C(N1)C(=O)C)C#N |
Computed by PubChem (NCBI)