Products 144690-18-6
CAS 144690-18-6 is the registry number for Itopride Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-ethyl-5-(2-hydroxypropan-2-yl)-1H-imidazole-4-carboxylate (CAS 144690-18-6) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: ethyl 2-ethyl-5-(2-hydroxypropan-2-yl)-1H-imidazole-4-carboxylate. InChIKey: YJOKBXJEPBIIEA-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | ethyl 2-ethyl-5-(2-hydroxypropan-2-yl)-1H-imidazole-4-carboxylate |
| InChIKey | YJOKBXJEPBIIEA-UHFFFAOYSA-N |
| SMILES | CCC1=NC(=C(N1)C(C)(C)O)C(=O)OCC |
Computed by PubChem (NCBI)