CAS 14474-71-6 appears in our catalog under these names: 3-Benzyl-6-isopropyl-2,5-Piperazinedione, Cyclo(Phe-Val), Antibacterial agent 134. Offered by: Chemat Brand, Biosynth, MedChemExpress. Available pack sizes: on request, 25mg, 10mg, 50mg, Get quote.
3-benzyl-6-propan-2-ylpiperazine-2,5-dione (CAS 14474-71-6) is a chemical compound with the molecular formula C14H18N2O2 and a molecular weight of 246.30 g/mol. IUPAC name: 3-benzyl-6-propan-2-ylpiperazine-2,5-dione. InChIKey: OQQPOHUVAQPSHJ-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O2 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | 3-benzyl-6-propan-2-ylpiperazine-2,5-dione |
| InChIKey | OQQPOHUVAQPSHJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1C(=O)NC(C(=O)N1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)