Products 144759-86-4
CAS 144759-86-4 appears in our catalog under these names: Cinnarizine Impurity 4, Cinnarizine Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
[(E)-3-[(E)-3-phenylprop-2-enoxy]prop-1-enyl]benzene (CAS 144759-86-4) is a chemical compound with the molecular formula C18H18O and a molecular weight of 250.3 g/mol. IUPAC name: [(E)-3-[(E)-3-phenylprop-2-enoxy]prop-1-enyl]benzene. InChIKey: SXZQETPZXHHVOY-FNCQTZNRSA-N.
| Molecular formula | C18H18O |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | [(E)-3-[(E)-3-phenylprop-2-enoxy]prop-1-enyl]benzene |
| InChIKey | SXZQETPZXHHVOY-FNCQTZNRSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/COC/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)