CAS 37904-84-0 appears in our catalog under these names: 2,6-Diphenylcyclohexanone, 95%, 2,6-Diphenylcyclohexanone, ≥97%,mixture of cis and trans, ≥97%,mixture of cis and trans. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg.
2,6-diphenylcyclohexan-1-one (CAS 37904-84-0) is a chemical compound with the molecular formula C18H18O and a molecular weight of 250.3 g/mol. IUPAC name: 2,6-diphenylcyclohexan-1-one. InChIKey: JHMUMWBKYPMOLI-UHFFFAOYSA-N.
| Molecular formula | C18H18O |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 2,6-diphenylcyclohexan-1-one |
| InChIKey | JHMUMWBKYPMOLI-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)C(C1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)