CAS 87172-18-7 is the registry number for (2E)-3-Mesityl-1-phenylprop-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
(E)-1-phenyl-3-(2,4,6-trimethylphenyl)prop-2-en-1-one (CAS 87172-18-7) is a chemical compound with the molecular formula C18H18O and a molecular weight of 250.3 g/mol. IUPAC name: (E)-1-phenyl-3-(2,4,6-trimethylphenyl)prop-2-en-1-one. InChIKey: KPFVYLKSZJDQAE-MDZDMXLPSA-N.
| Molecular formula | C18H18O |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | (E)-1-phenyl-3-(2,4,6-trimethylphenyl)prop-2-en-1-one |
| InChIKey | KPFVYLKSZJDQAE-MDZDMXLPSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)/C=C/C(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)