Products 2460800-45-5
CAS 2460800-45-5 is the registry number for 5-(4-(tert-Butyl)phenyl)benzofuran, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-tert-butylphenyl)-1-benzofuran (CAS 2460800-45-5) is a chemical compound with the molecular formula C18H18O and a molecular weight of 250.3 g/mol. IUPAC name: 5-(4-tert-butylphenyl)-1-benzofuran. InChIKey: AOEXJRXUHQUKTQ-UHFFFAOYSA-N.
| Molecular formula | C18H18O |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 5-(4-tert-butylphenyl)-1-benzofuran |
| InChIKey | AOEXJRXUHQUKTQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC3=C(C=C2)OC=C3 |
Computed by PubChem (NCBI)