Products 1447943-65-8

CAS 1447943-65-8 is the registry number for 2,2-Difluoro-2-(1-methoxycyclohexyl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2,2-difluoro-2-(1-methoxycyclohexyl)acetic acid (CAS 1447943-65-8) is a chemical compound with the molecular formula C9H14F2O3 and a molecular weight of 208.20 g/mol. IUPAC name: 2,2-difluoro-2-(1-methoxycyclohexyl)acetic acid. InChIKey: CHJVQDFNFQWINE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14F2O3
Molecular weight208.20 g/mol
IUPAC name2,2-difluoro-2-(1-methoxycyclohexyl)acetic acid
InChIKeyCHJVQDFNFQWINE-UHFFFAOYSA-N
SMILESCOC1(CCCCC1)C(C(=O)O)(F)F

Computed by PubChem (NCBI)