CAS 1558011-17-8 is the registry number for (S)-1-((R)-2,2-Dimethyl-1,3-dioxolan-4-yl)-2,2-difluorobut-3-en-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluorobut-3-en-1-ol (CAS 1558011-17-8) is a chemical compound with the molecular formula C9H14F2O3 and a molecular weight of 208.20 g/mol. IUPAC name: 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluorobut-3-en-1-ol. InChIKey: NTJMUNNQVVUTJS-UHFFFAOYSA-N.
| Molecular formula | C9H14F2O3 |
|---|---|
| Molecular weight | 208.20 g/mol |
| IUPAC name | 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluorobut-3-en-1-ol |
| InChIKey | NTJMUNNQVVUTJS-UHFFFAOYSA-N |
| SMILES | CC1(OCC(O1)C(C(C=C)(F)F)O)C |
Computed by PubChem (NCBI)