Products 2940876-01-5
CAS 2940876-01-5 is the registry number for ethyl (1R,2S)-5,5-difluoro-2-hydroxy-cyclohexanecarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Cis-ethyl (1R,2S)-5,5-difluoro-2-hydroxycyclohexane-1-carboxylate (CAS 2940876-01-5) is a chemical compound with the molecular formula C9H14F2O3 and a molecular weight of 208.20 g/mol. IUPAC name: cis-ethyl (1R,2S)-5,5-difluoro-2-hydroxycyclohexane-1-carboxylate. InChIKey: RJFOTQAHXBXVKZ-RQJHMYQMSA-N.
| Molecular formula | C9H14F2O3 |
|---|---|
| Molecular weight | 208.20 g/mol |
| IUPAC name | cis-ethyl (1R,2S)-5,5-difluoro-2-hydroxycyclohexane-1-carboxylate |
| InChIKey | RJFOTQAHXBXVKZ-RQJHMYQMSA-N |
| SMILES | CCOC(=O)[C@@H]1CC(CC[C@@H]1O)(F)F |
Computed by PubChem (NCBI)