Products 1645565-02-1
CAS 1645565-02-1 is the registry number for Isopropyl 3,3-difluoro-1-(hydroxymethyl)cyclobutane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl 3,3-difluoro-1-(hydroxymethyl)cyclobutane-1-carboxylate (CAS 1645565-02-1) is a chemical compound with the molecular formula C9H14F2O3 and a molecular weight of 208.20 g/mol. IUPAC name: propan-2-yl 3,3-difluoro-1-(hydroxymethyl)cyclobutane-1-carboxylate. InChIKey: DIFRZEZCZXPYSO-UHFFFAOYSA-N.
| Molecular formula | C9H14F2O3 |
|---|---|
| Molecular weight | 208.20 g/mol |
| IUPAC name | propan-2-yl 3,3-difluoro-1-(hydroxymethyl)cyclobutane-1-carboxylate |
| InChIKey | DIFRZEZCZXPYSO-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1(CC(C1)(F)F)CO |
Computed by PubChem (NCBI)