Products 1448009-94-6
CAS 1448009-94-6 appears in our catalog under these names: CS1, 4-(6-Hydroxynaphthalen-2-yl)benzene-1,2-diol. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 100mg, 50mg, Get quote.
4-(6-hydroxynaphthalen-2-yl)benzene-1,2-diol (CAS 1448009-94-6) is a chemical compound with the molecular formula C16H12O3 and a molecular weight of 252.26 g/mol. IUPAC name: 4-(6-hydroxynaphthalen-2-yl)benzene-1,2-diol. InChIKey: LDFFDYWHCCDSBO-UHFFFAOYSA-N.
| Molecular formula | C16H12O3 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 4-(6-hydroxynaphthalen-2-yl)benzene-1,2-diol |
| InChIKey | LDFFDYWHCCDSBO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)O)C=C1C3=CC(=C(C=C3)O)O |
Computed by PubChem (NCBI)