CAS 144809-27-8 is the registry number for 5-Ethyl-2-pyridineethanol Tosylate. Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
2-(5-ethyl-2-pyridinyl)ethyl 4-methylbenzenesulfonate (CAS 144809-27-8) is a chemical compound with the molecular formula C16H19NO3S and a molecular weight of 305.4 g/mol. IUPAC name: 2-(5-ethyl-2-pyridinyl)ethyl 4-methylbenzenesulfonate. InChIKey: XOKOJAMQAAPMRF-UHFFFAOYSA-N.
| Molecular formula | C16H19NO3S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 2-(5-ethyl-2-pyridinyl)ethyl 4-methylbenzenesulfonate |
| InChIKey | XOKOJAMQAAPMRF-UHFFFAOYSA-N |
| SMILES | CCC1=CN=C(C=C1)CCOS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)