Products 144809-27-8

CAS 144809-27-8 is the registry number for 5-Ethyl-2-pyridineethanol Tosylate. Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.

Structural formula: {0} (CAS {1})

2-(5-ethyl-2-pyridinyl)ethyl 4-methylbenzenesulfonate (CAS 144809-27-8) is a chemical compound with the molecular formula C16H19NO3S and a molecular weight of 305.4 g/mol. IUPAC name: 2-(5-ethyl-2-pyridinyl)ethyl 4-methylbenzenesulfonate. InChIKey: XOKOJAMQAAPMRF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H19NO3S
Molecular weight305.4 g/mol
IUPAC name2-(5-ethyl-2-pyridinyl)ethyl 4-methylbenzenesulfonate
InChIKeyXOKOJAMQAAPMRF-UHFFFAOYSA-N
SMILESCCC1=CN=C(C=C1)CCOS(=O)(=O)C2=CC=C(C=C2)C

Computed by PubChem (NCBI)