Products 68892-12-6

CAS 68892-12-6 is the registry number for 2-((ethyl(m-tolyl)amino)methyl)benzenesulfonic acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(N-ethyl-3-methylanilino)methyl]benzenesulfonic acid (CAS 68892-12-6) is a chemical compound with the molecular formula C16H19NO3S and a molecular weight of 305.4 g/mol. IUPAC name: 2-[(N-ethyl-3-methylanilino)methyl]benzenesulfonic acid. InChIKey: KJGKGAPEKFTEIL-UHFFFAOYSA-N.

Identity
Molecular formulaC16H19NO3S
Molecular weight305.4 g/mol
IUPAC name2-[(N-ethyl-3-methylanilino)methyl]benzenesulfonic acid
InChIKeyKJGKGAPEKFTEIL-UHFFFAOYSA-N
SMILESCCN(CC1=CC=CC=C1S(=O)(=O)O)C2=CC=CC(=C2)C

Computed by PubChem (NCBI)