CAS 91-98-5 appears in our catalog under these names: N-Ethyl-N-(m-tosyl)-m-toluidine, N-Ethyl-N-(m-tolylsulfonyl)-3-methylaniline. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5kg, 1kg.
3-[(N-ethyl-3-methylanilino)methyl]benzenesulfonic acid (CAS 91-98-5) is a chemical compound with the molecular formula C16H19NO3S and a molecular weight of 305.4 g/mol. IUPAC name: 3-[(N-ethyl-3-methylanilino)methyl]benzenesulfonic acid. InChIKey: QAHDKLRCWZENIP-UHFFFAOYSA-N.
| Molecular formula | C16H19NO3S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 3-[(N-ethyl-3-methylanilino)methyl]benzenesulfonic acid |
| InChIKey | QAHDKLRCWZENIP-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CC(=CC=C1)S(=O)(=O)O)C2=CC=CC(=C2)C |
Computed by PubChem (NCBI)