CAS 305849-21-2 is the registry number for N-(4-Methoxyphenyl)-2,4,6-trimethylbenzene-1-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(4-methoxyphenyl)-2,4,6-trimethylbenzenesulfonamide (CAS 305849-21-2) is a chemical compound with the molecular formula C16H19NO3S and a molecular weight of 305.4 g/mol. IUPAC name: N-(4-methoxyphenyl)-2,4,6-trimethylbenzenesulfonamide. InChIKey: SZRCZRBFSIPIHK-UHFFFAOYSA-N.
| Molecular formula | C16H19NO3S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | N-(4-methoxyphenyl)-2,4,6-trimethylbenzenesulfonamide |
| InChIKey | SZRCZRBFSIPIHK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)NC2=CC=C(C=C2)OC)C |
Computed by PubChem (NCBI)