CAS 1448361-59-8 is the registry number for 1-(4,6-Dichloro-1,5-naphthyridin-3-yl)ethan-1-one, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
1-(4,6-dichloro-1,5-naphthyridin-3-yl)ethanone (CAS 1448361-59-8) is a chemical compound with the molecular formula C10H6Cl2N2O and a molecular weight of 241.07 g/mol. IUPAC name: 1-(4,6-dichloro-1,5-naphthyridin-3-yl)ethanone. InChIKey: OOOXAJHVXIIYRJ-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O |
|---|---|
| Molecular weight | 241.07 g/mol |
| IUPAC name | 1-(4,6-dichloro-1,5-naphthyridin-3-yl)ethanone |
| InChIKey | OOOXAJHVXIIYRJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C2C=CC(=NC2=C1Cl)Cl |
Computed by PubChem (NCBI)