Products 1448673-87-7

CAS 1448673-87-7 is the registry number for 2-[2-(Tetrahydro-pyran-2-yloxy)-ethoxy]-thiazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[2-(oxan-2-yloxy)ethoxy]-1,3-thiazole-4-carboxylic acid (CAS 1448673-87-7) is a chemical compound with the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. IUPAC name: 2-[2-(oxan-2-yloxy)ethoxy]-1,3-thiazole-4-carboxylic acid. InChIKey: QYKMXOQBSUGIQR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO5S
Molecular weight273.31 g/mol
IUPAC name2-[2-(oxan-2-yloxy)ethoxy]-1,3-thiazole-4-carboxylic acid
InChIKeyQYKMXOQBSUGIQR-UHFFFAOYSA-N
SMILESC1CCOC(C1)OCCOC2=NC(=CS2)C(=O)O

Computed by PubChem (NCBI)