CAS 91280-33-0 appears in our catalog under these names: 3-Hydroxy-2-([(4-methylphenyl)sulfonyl]amino)butanoic acid, 95%, 3-Hydroxy-2-(4-methylphenylsulfonamido)butanoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-hydroxy-2-[(4-methylphenyl)sulfonylamino]butanoic acid (CAS 91280-33-0) is a chemical compound with the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. IUPAC name: 3-hydroxy-2-[(4-methylphenyl)sulfonylamino]butanoic acid. InChIKey: SZILOGOOPIXJAQ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO5S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 3-hydroxy-2-[(4-methylphenyl)sulfonylamino]butanoic acid |
| InChIKey | SZILOGOOPIXJAQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(C(C)O)C(=O)O |
Computed by PubChem (NCBI)