Products 333357-41-8

CAS 333357-41-8 is the registry number for N-(4-Ethoxyphenyl)-n-(methylsulfonyl)glycine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-ethoxy-N-methylsulfonylanilino)acetic acid (CAS 333357-41-8) is a chemical compound with the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. IUPAC name: 2-(4-ethoxy-N-methylsulfonylanilino)acetic acid. InChIKey: KFHXOWMQJJEKLV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO5S
Molecular weight273.31 g/mol
IUPAC name2-(4-ethoxy-N-methylsulfonylanilino)acetic acid
InChIKeyKFHXOWMQJJEKLV-UHFFFAOYSA-N
SMILESCCOC1=CC=C(C=C1)N(CC(=O)O)S(=O)(=O)C

Computed by PubChem (NCBI)