CAS 491844-57-6 is the registry number for N-(2-Methoxy-5-methylphenyl)-n-(methylsulfonyl)glycine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2-methoxy-5-methyl-N-methylsulfonylanilino)acetic acid (CAS 491844-57-6) is a chemical compound with the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. IUPAC name: 2-(2-methoxy-5-methyl-N-methylsulfonylanilino)acetic acid. InChIKey: GMRVOGGLRJKCGD-UHFFFAOYSA-N.
| Molecular formula | C11H15NO5S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 2-(2-methoxy-5-methyl-N-methylsulfonylanilino)acetic acid |
| InChIKey | GMRVOGGLRJKCGD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)N(CC(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)