Products 144868-18-8
CAS 144868-18-8 appears in our catalog under these names: 3–Methyl–L–histidine–d3, 3-Methyl-L-histidine-d3, 99.8%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 1 mg, 5 mg, 10 mg.
(2S)-2-amino-3-[3-(trideuteriomethyl)imidazol-4-yl]propanoic acid (CAS 144868-18-8) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 172.20 g/mol. IUPAC name: (2S)-2-amino-3-[3-(trideuteriomethyl)imidazol-4-yl]propanoic acid. InChIKey: JDHILDINMRGULE-FYFSCIFKSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 172.20 g/mol |
| IUPAC name | (2S)-2-amino-3-[3-(trideuteriomethyl)imidazol-4-yl]propanoic acid |
| InChIKey | JDHILDINMRGULE-FYFSCIFKSA-N |
| SMILES | [2H]C([2H])([2H])N1C=NC=C1C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)